C21H27FN2O2 — CID 127252480
(3aS,7aS)-1-(cyclopentanecarbonyl)-4-[(2-fluorophenyl)methyl]-3a-methyl-3,6,7,7a-tetrahydro-2H-pyrrolo[3,2-b]pyridin-5-one (PubChem CID 127252480) has the molecular formula C21H27FN2O2 and a molecular weight of 358.46 g/mol. Its IUPAC name is (3aS,7aS)-1-(cyclopentanecarbonyl)-4-[(2-fluorophenyl)methyl]-3a-methyl-3,6,7,7a-tetrahydro-2H-pyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aS,7aS)-1-(cyclopentanecarbonyl)-4-[(2-fluorophenyl)methyl]-3a-methyl-3,6,7,7a-tetrahydro-2H-pyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 127252480 |
| Molecular Formula | C21H27FN2O2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (3aS,7aS)-1-(cyclopentanecarbonyl)-4-[(2-fluorophenyl)methyl]-3a-methyl-3,6,7,7a-tetrahydro-2H-pyrrolo[3,2-b]pyridin-5-one |
| SMILES | C[C@]12CCN(C(=O)C3CCCC3)[C@H]1CCC(=O)N2Cc1ccccc1F |
| InChI | InChI=1S/C21H27FN2O2/c1-21-12-13-23(20(26)15-6-2-3-7-15)18(21)10-11-19(25)24(21)14-16-8-4-5-9-17(16)22/h4-5,8-9,15,18H,2-3,6-7,10-14H2,1H3/t18-,21-/m0/s1 |
| InChIKey | MJIMQYYPVDRPEA-RXVVDRJESA-N |
| XLogP | 3.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |