C19H23FN4O — CID 110137828
(3aS,7aS)-4-[(2-fluorophenyl)methyl]-1-(1H-imidazol-2-ylmethyl)-3a-methyl-3,6,7,7a-tetrahydro-2H-pyrrolo[3,2-b]pyridin-5-one (PubChem CID 110137828) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is (3aS,7aS)-4-[(2-fluorophenyl)methyl]-1-(1H-imidazol-2-ylmethyl)-3a-methyl-3,6,7,7a-tetrahydro-2H-pyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aS,7aS)-4-[(2-fluorophenyl)methyl]-1-(1H-imidazol-2-ylmethyl)-3a-methyl-3,6,7,7a-tetrahydro-2H-pyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 110137828 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (3aS,7aS)-4-[(2-fluorophenyl)methyl]-1-(1H-imidazol-2-ylmethyl)-3a-methyl-3,6,7,7a-tetrahydro-2H-pyrrolo[3,2-b]pyridin-5-one |
| SMILES | C[C@]12CCN(Cc3ncc[nH]3)[C@H]1CCC(=O)N2Cc1ccccc1F |
| InChI | InChI=1S/C19H23FN4O/c1-19-8-11-23(13-17-21-9-10-22-17)16(19)6-7-18(25)24(19)12-14-4-2-3-5-15(14)20/h2-5,9-10,16H,6-8,11-13H2,1H3,(H,21,22)/t16-,19-/m0/s1 |
| InChIKey | DOYWQTVLUAOMOT-LPHOPBHVSA-N |
| XLogP | 2.70 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |