C16H23NO6S — CID 11013751
ethyl 3-hydroxy-3-(methoxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 11013751) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is ethyl 3-hydroxy-3-(methoxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | ethyl 3-hydroxy-3-(methoxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11013751 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | ethyl 3-hydroxy-3-(methoxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1N(S(=O)(=O)c2ccc(C)cc2)CCC1(O)COC |
| InChI | InChI=1S/C16H23NO6S/c1-4-23-15(18)14-16(19,11-22-3)9-10-17(14)24(20,21)13-7-5-12(2)6-8-13/h5-8,14,19H,4,9-11H2,1-3H3 |
| InChIKey | XQXHIMNNARAFMW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |