C19H20ClFN2O — CID 110138636
2-[(4-chloro-3-fluorophenyl)methyl]-7-(pyridin-3-ylmethyl)-6-oxa-2-azaspiro[3.4]octane (PubChem CID 110138636) has the molecular formula C19H20ClFN2O and a molecular weight of 346.83 g/mol. Its IUPAC name is 2-[(4-chloro-3-fluorophenyl)methyl]-7-(pyridin-3-ylmethyl)-6-oxa-2-azaspiro[3.4]octane.
| Compound Name | 2-[(4-chloro-3-fluorophenyl)methyl]-7-(pyridin-3-ylmethyl)-6-oxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 110138636 |
| Molecular Formula | C19H20ClFN2O |
| Molecular Weight | 346.83 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-[(4-chloro-3-fluorophenyl)methyl]-7-(pyridin-3-ylmethyl)-6-oxa-2-azaspiro[3.4]octane |
| SMILES | Fc1cc(CN2CC3(COC(Cc4cccnc4)C3)C2)ccc1Cl |
| InChI | InChI=1S/C19H20ClFN2O/c20-17-4-3-15(7-18(17)21)10-23-11-19(12-23)8-16(24-13-19)6-14-2-1-5-22-9-14/h1-5,7,9,16H,6,8,10-13H2 |
| InChIKey | VALFYMUOXWVSBV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.83 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |