C21H30N2O2 — CID 125009836
cyclohexyl-[(3R)-3-(pyridin-3-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]methanone (PubChem CID 125009836) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is cyclohexyl-[(3R)-3-(pyridin-3-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]methanone.
| Compound Name | cyclohexyl-[(3R)-3-(pyridin-3-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
|---|---|
| PubChem CID | 125009836 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | cyclohexyl-[(3R)-3-(pyridin-3-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1CCC2(CC1)CO[C@H](Cc1cccnc1)C2 |
| InChI | InChI=1S/C21H30N2O2/c24-20(18-6-2-1-3-7-18)23-11-8-21(9-12-23)14-19(25-16-21)13-17-5-4-10-22-15-17/h4-5,10,15,18-19H,1-3,6-9,11-14,16H2/t19-/m1/s1 |
| InChIKey | VFDRMFLVCFUHFS-LJQANCHMSA-N |
| XLogP | 3.60 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |