C23H35N3O2 — CID 91916226
cyclohexyl-[4-[oxan-4-yl(pyridin-3-ylmethyl)amino]piperidin-1-yl]methanone (PubChem CID 91916226) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is cyclohexyl-[4-[oxan-4-yl(pyridin-3-ylmethyl)amino]piperidin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-[oxan-4-yl(pyridin-3-ylmethyl)amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 91916226 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | cyclohexyl-[4-[oxan-4-yl(pyridin-3-ylmethyl)amino]piperidin-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1CCC(N(Cc2cccnc2)C2CCOCC2)CC1 |
| InChI | InChI=1S/C23H35N3O2/c27-23(20-6-2-1-3-7-20)25-13-8-21(9-14-25)26(22-10-15-28-16-11-22)18-19-5-4-12-24-17-19/h4-5,12,17,20-22H,1-3,6-11,13-16,18H2 |
| InChIKey | FOXJMKZPFHVAFH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |