C16H27NO4 — CID 97418040
[(3R)-3-(methoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-(oxan-4-yl)methanone (PubChem CID 97418040) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is [(3R)-3-(methoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-(oxan-4-yl)methanone.
| Compound Name | [(3R)-3-(methoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 97418040 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | [(3R)-3-(methoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-(oxan-4-yl)methanone |
| SMILES | COC[C@H]1CC2(CCN(C(=O)C3CCOCC3)CC2)CO1 |
| InChI | InChI=1S/C16H27NO4/c1-19-11-14-10-16(12-21-14)4-6-17(7-5-16)15(18)13-2-8-20-9-3-13/h13-14H,2-12H2,1H3/t14-/m1/s1 |
| InChIKey | UWURLQOYVNHARL-CQSZACIVSA-N |
| XLogP | 1.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |