C13H23NO5S — CID 97485383
1-[(3R)-3-(methoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-2-methylsulfonylethanone (PubChem CID 97485383) has the molecular formula C13H23NO5S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-[(3R)-3-(methoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-2-methylsulfonylethanone.
| Compound Name | 1-[(3R)-3-(methoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 97485383 |
| Molecular Formula | C13H23NO5S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-[(3R)-3-(methoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-2-methylsulfonylethanone |
| SMILES | COC[C@H]1CC2(CCN(C(=O)CS(C)(=O)=O)CC2)CO1 |
| InChI | InChI=1S/C13H23NO5S/c1-18-8-11-7-13(10-19-11)3-5-14(6-4-13)12(15)9-20(2,16)17/h11H,3-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | XPZGLCBXXFXDMG-LLVKDONJSA-N |
| XLogP | 0.08 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |