C17H25NO4S — CID 97473995
(3R)-3-(methoxymethyl)-8-(3-methylphenyl)sulfonyl-2-oxa-8-azaspiro[4.5]decane (PubChem CID 97473995) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is (3R)-3-(methoxymethyl)-8-(3-methylphenyl)sulfonyl-2-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3R)-3-(methoxymethyl)-8-(3-methylphenyl)sulfonyl-2-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97473995 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (3R)-3-(methoxymethyl)-8-(3-methylphenyl)sulfonyl-2-oxa-8-azaspiro[4.5]decane |
| SMILES | COC[C@H]1CC2(CCN(S(=O)(=O)c3cccc(C)c3)CC2)CO1 |
| InChI | InChI=1S/C17H25NO4S/c1-14-4-3-5-16(10-14)23(19,20)18-8-6-17(7-9-18)11-15(12-21-2)22-13-17/h3-5,10,15H,6-9,11-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | KNGJKVFMXSOHJS-OAHLLOKOSA-N |
| XLogP | 2.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |