C21H32N2O3S — CID 131678624
8-(benzenesulfonyl)-3-[(3-methylpiperidin-1-yl)methyl]-2-oxa-8-azaspiro[4.5]decane (PubChem CID 131678624) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-3-[(3-methylpiperidin-1-yl)methyl]-2-oxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(benzenesulfonyl)-3-[(3-methylpiperidin-1-yl)methyl]-2-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 131678624 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 8-(benzenesulfonyl)-3-[(3-methylpiperidin-1-yl)methyl]-2-oxa-8-azaspiro[4.5]decane |
| SMILES | CC1CCCN(CC2CC3(CCN(S(=O)(=O)c4ccccc4)CC3)CO2)C1 |
| InChI | InChI=1S/C21H32N2O3S/c1-18-6-5-11-22(15-18)16-19-14-21(17-26-19)9-12-23(13-10-21)27(24,25)20-7-3-2-4-8-20/h2-4,7-8,18-19H,5-6,9-17H2,1H3 |
| InChIKey | DAUUMTSXCGXEHK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |