C19H28N2O4S — CID 131678633
1-[[8-(benzenesulfonyl)-2-oxa-8-azaspiro[4.5]decan-3-yl]methyl]pyrrolidin-3-ol (PubChem CID 131678633) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-[[8-(benzenesulfonyl)-2-oxa-8-azaspiro[4.5]decan-3-yl]methyl]pyrrolidin-3-ol.
| Compound Name | 1-[[8-(benzenesulfonyl)-2-oxa-8-azaspiro[4.5]decan-3-yl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 131678633 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-[[8-(benzenesulfonyl)-2-oxa-8-azaspiro[4.5]decan-3-yl]methyl]pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1ccccc1)N1CCC2(CC1)COC(CN1CCC(O)C1)C2 |
| InChI | InChI=1S/C19H28N2O4S/c22-16-6-9-20(13-16)14-17-12-19(15-25-17)7-10-21(11-8-19)26(23,24)18-4-2-1-3-5-18/h1-5,16-17,22H,6-15H2 |
| InChIKey | YXOANTPAAHEZPW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |