C12H21NO5S — CID 97423008
1-[(3R)-3-methoxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-2-methylsulfonylethanone (PubChem CID 97423008) has the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. Its IUPAC name is 1-[(3R)-3-methoxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-2-methylsulfonylethanone.
| Compound Name | 1-[(3R)-3-methoxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 97423008 |
| Molecular Formula | C12H21NO5S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-[(3R)-3-methoxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-2-methylsulfonylethanone |
| SMILES | CO[C@H]1COC2(CCN(C(=O)CS(C)(=O)=O)CC2)C1 |
| InChI | InChI=1S/C12H21NO5S/c1-17-10-7-12(18-8-10)3-5-13(6-4-12)11(14)9-19(2,15)16/h10H,3-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | UPDUNKSEAAYRFZ-SNVBAGLBSA-N |
| XLogP | -0.17 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |