C10H17NO4S2 — CID 131639249
1-(7-methoxy-5-thia-2-azaspiro[3.4]octan-2-yl)-2-methylsulfonylethanone (PubChem CID 131639249) has the molecular formula C10H17NO4S2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-(7-methoxy-5-thia-2-azaspiro[3.4]octan-2-yl)-2-methylsulfonylethanone.
| Compound Name | 1-(7-methoxy-5-thia-2-azaspiro[3.4]octan-2-yl)-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 131639249 |
| Molecular Formula | C10H17NO4S2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 1-(7-methoxy-5-thia-2-azaspiro[3.4]octan-2-yl)-2-methylsulfonylethanone |
| SMILES | COC1CSC2(C1)CN(C(=O)CS(C)(=O)=O)C2 |
| InChI | InChI=1S/C10H17NO4S2/c1-15-8-3-10(16-4-8)6-11(7-10)9(12)5-17(2,13)14/h8H,3-7H2,1-2H3 |
| InChIKey | NSWXDRQSNUZBLP-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |