C16H27NO4S — CID 131692247
2-ethoxy-1-[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]ethanone (PubChem CID 131692247) has the molecular formula C16H27NO4S and a molecular weight of 329.46 g/mol. Its IUPAC name is 2-ethoxy-1-[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]ethanone.
| Compound Name | 2-ethoxy-1-[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]ethanone |
|---|---|
| PubChem CID | 131692247 |
| Molecular Formula | C16H27NO4S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-ethoxy-1-[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]ethanone |
| SMILES | CCOCC(=O)N1CC2(CC(OCC3CCOCC3)CS2)C1 |
| InChI | InChI=1S/C16H27NO4S/c1-2-19-9-15(18)17-11-16(12-17)7-14(10-22-16)21-8-13-3-5-20-6-4-13/h13-14H,2-12H2,1H3 |
| InChIKey | PPCHCIOPDRIQSY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |