C20H31NO3S — CID 131663393
2-(cyclohexen-1-yl)-1-[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]ethanone (PubChem CID 131663393) has the molecular formula C20H31NO3S and a molecular weight of 365.54 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]ethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1-[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]ethanone |
|---|---|
| PubChem CID | 131663393 |
| Molecular Formula | C20H31NO3S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]ethanone |
| SMILES | O=C(CC1=CCCCC1)N1CC2(CC(OCC3CCOCC3)CS2)C1 |
| InChI | InChI=1S/C20H31NO3S/c22-19(10-16-4-2-1-3-5-16)21-14-20(15-21)11-18(13-25-20)24-12-17-6-8-23-9-7-17/h4,17-18H,1-3,5-15H2 |
| InChIKey | JJFZMEQMHCPXIH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|