C16H25NO3S — CID 124791159
[(7R)-7-(cyclopropylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]-(oxan-4-yl)methanone (PubChem CID 124791159) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is [(7R)-7-(cyclopropylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]-(oxan-4-yl)methanone.
| Compound Name | [(7R)-7-(cyclopropylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 124791159 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | [(7R)-7-(cyclopropylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]-(oxan-4-yl)methanone |
| SMILES | O=C(C1CCOCC1)N1CC2(C[C@@H](OCC3CC3)CS2)C1 |
| InChI | InChI=1S/C16H25NO3S/c18-15(13-3-5-19-6-4-13)17-10-16(11-17)7-14(9-21-16)20-8-12-1-2-12/h12-14H,1-11H2/t14-/m1/s1 |
| InChIKey | GDQSHWYBRZXTDB-CQSZACIVSA-N |
| XLogP | 1.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |