C18H24N2O3S — CID 131662707
[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]-pyridin-4-ylmethanone (PubChem CID 131662707) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is [7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]-pyridin-4-ylmethanone.
| Compound Name | [7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 131662707 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1CC2(CC(OCC3CCOCC3)CS2)C1 |
| InChI | InChI=1S/C18H24N2O3S/c21-17(15-1-5-19-6-2-15)20-12-18(13-20)9-16(11-24-18)23-10-14-3-7-22-8-4-14/h1-2,5-6,14,16H,3-4,7-13H2 |
| InChIKey | KKABVBMIYBEWSU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |