C19H24FNO3S — CID 131677662
(3-fluorophenyl)-[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]methanone (PubChem CID 131677662) has the molecular formula C19H24FNO3S and a molecular weight of 365.47 g/mol. Its IUPAC name is (3-fluorophenyl)-[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]methanone.
| Compound Name | (3-fluorophenyl)-[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]methanone |
|---|---|
| PubChem CID | 131677662 |
| Molecular Formula | C19H24FNO3S |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (3-fluorophenyl)-[7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]methanone |
| SMILES | O=C(c1cccc(F)c1)N1CC2(CC(OCC3CCOCC3)CS2)C1 |
| InChI | InChI=1S/C19H24FNO3S/c20-16-3-1-2-15(8-16)18(22)21-12-19(13-21)9-17(11-25-19)24-10-14-4-6-23-7-5-14/h1-3,8,14,17H,4-7,9-13H2 |
| InChIKey | GRKOSFFSRPAFJI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |