C19H31NO4 — CID 97418259
[(3S)-3-(cyclopropylmethoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-(oxan-4-yl)methanone (PubChem CID 97418259) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is [(3S)-3-(cyclopropylmethoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-(oxan-4-yl)methanone.
| Compound Name | [(3S)-3-(cyclopropylmethoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 97418259 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | [(3S)-3-(cyclopropylmethoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-(oxan-4-yl)methanone |
| SMILES | O=C(C1CCOCC1)N1CCC2(CC1)CO[C@H](COCC1CC1)C2 |
| InChI | InChI=1S/C19H31NO4/c21-18(16-3-9-22-10-4-16)20-7-5-19(6-8-20)11-17(24-14-19)13-23-12-15-1-2-15/h15-17H,1-14H2/t17-/m0/s1 |
| InChIKey | WTJQRMWFCZWCIZ-KRWDZBQOSA-N |
| XLogP | 2.24 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |