C20H31NO4 — CID 97418289
(3R)-8-(furan-3-ylmethyl)-3-(oxan-4-ylmethoxymethyl)-2-oxa-8-azaspiro[4.5]decane (PubChem CID 97418289) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is (3R)-8-(furan-3-ylmethyl)-3-(oxan-4-ylmethoxymethyl)-2-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3R)-8-(furan-3-ylmethyl)-3-(oxan-4-ylmethoxymethyl)-2-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97418289 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | (3R)-8-(furan-3-ylmethyl)-3-(oxan-4-ylmethoxymethyl)-2-oxa-8-azaspiro[4.5]decane |
| SMILES | c1cc(CN2CCC3(CC2)CO[C@@H](COCC2CCOCC2)C3)co1 |
| InChI | InChI=1S/C20H31NO4/c1-8-22-9-2-17(1)13-24-15-19-11-20(16-25-19)4-6-21(7-5-20)12-18-3-10-23-14-18/h3,10,14,17,19H,1-2,4-9,11-13,15-16H2/t19-/m1/s1 |
| InChIKey | SCKJYABAGFTROS-LJQANCHMSA-N |
| XLogP | 3.09 |
| TPSA | 44.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |