C18H27NO4 — CID 124805158
(8R)-2-(furan-3-ylmethyl)-8-(oxan-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonane (PubChem CID 124805158) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (8R)-2-(furan-3-ylmethyl)-8-(oxan-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonane.
| Compound Name | (8R)-2-(furan-3-ylmethyl)-8-(oxan-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 124805158 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (8R)-2-(furan-3-ylmethyl)-8-(oxan-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonane |
| SMILES | c1cc(CN2CC3(C[C@H](OCC4CCOCC4)CCO3)C2)co1 |
| InChI | InChI=1S/C18H27NO4/c1-5-20-6-2-15(1)12-22-17-4-8-23-18(9-17)13-19(14-18)10-16-3-7-21-11-16/h3,7,11,15,17H,1-2,4-6,8-10,12-14H2/t17-/m1/s1 |
| InChIKey | YQRWNQWHZYHVKS-QGZVFWFLSA-N |
| XLogP | 2.46 |
| TPSA | 44.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |