C21H28FNO4 — CID 124792285
2-(4-fluorophenyl)-1-[(8R)-8-(oxan-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonan-2-yl]ethanone (PubChem CID 124792285) has the molecular formula C21H28FNO4 and a molecular weight of 377.46 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[(8R)-8-(oxan-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonan-2-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)-1-[(8R)-8-(oxan-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonan-2-yl]ethanone |
|---|---|
| PubChem CID | 124792285 |
| Molecular Formula | C21H28FNO4 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[(8R)-8-(oxan-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonan-2-yl]ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)N1CC2(C[C@H](OCC3CCOCC3)CCO2)C1 |
| InChI | InChI=1S/C21H28FNO4/c22-18-3-1-16(2-4-18)11-20(24)23-14-21(15-23)12-19(7-10-27-21)26-13-17-5-8-25-9-6-17/h1-4,17,19H,5-15H2/t19-/m1/s1 |
| InChIKey | JGWOBONTTLIQFF-LJQANCHMSA-N |
| XLogP | 2.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |