C18H27NO3 — CID 97419173
(3S)-3-(cyclobutylmethoxy)-8-(furan-3-ylmethyl)-1-oxa-8-azaspiro[4.5]decane (PubChem CID 97419173) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (3S)-3-(cyclobutylmethoxy)-8-(furan-3-ylmethyl)-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3S)-3-(cyclobutylmethoxy)-8-(furan-3-ylmethyl)-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97419173 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (3S)-3-(cyclobutylmethoxy)-8-(furan-3-ylmethyl)-1-oxa-8-azaspiro[4.5]decane |
| SMILES | c1cc(CN2CCC3(CC2)C[C@H](OCC2CCC2)CO3)co1 |
| InChI | InChI=1S/C18H27NO3/c1-2-15(3-1)13-21-17-10-18(22-14-17)5-7-19(8-6-18)11-16-4-9-20-12-16/h4,9,12,15,17H,1-3,5-8,10-11,13-14H2/t17-/m0/s1 |
| InChIKey | OXLWRABQIDFKSU-KRWDZBQOSA-N |
| XLogP | 3.22 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |