C20H29NO3 — CID 97418851
(3S)-3-(cyclopropylmethoxy)-8-[(3-methoxyphenyl)methyl]-1-oxa-8-azaspiro[4.5]decane (PubChem CID 97418851) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (3S)-3-(cyclopropylmethoxy)-8-[(3-methoxyphenyl)methyl]-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3S)-3-(cyclopropylmethoxy)-8-[(3-methoxyphenyl)methyl]-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97418851 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (3S)-3-(cyclopropylmethoxy)-8-[(3-methoxyphenyl)methyl]-1-oxa-8-azaspiro[4.5]decane |
| SMILES | COc1cccc(CN2CCC3(CC2)C[C@H](OCC2CC2)CO3)c1 |
| InChI | InChI=1S/C20H29NO3/c1-22-18-4-2-3-17(11-18)13-21-9-7-20(8-10-21)12-19(15-24-20)23-14-16-5-6-16/h2-4,11,16,19H,5-10,12-15H2,1H3/t19-/m0/s1 |
| InChIKey | ZBMJLULNFAJBQH-IBGZPJMESA-N |
| XLogP | 3.25 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |