C22H33NO3 — CID 97418922
(3R)-8-[(2-methylphenyl)methyl]-3-(oxan-4-ylmethoxy)-1-oxa-8-azaspiro[4.5]decane (PubChem CID 97418922) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is (3R)-8-[(2-methylphenyl)methyl]-3-(oxan-4-ylmethoxy)-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3R)-8-[(2-methylphenyl)methyl]-3-(oxan-4-ylmethoxy)-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97418922 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (3R)-8-[(2-methylphenyl)methyl]-3-(oxan-4-ylmethoxy)-1-oxa-8-azaspiro[4.5]decane |
| SMILES | Cc1ccccc1CN1CCC2(CC1)C[C@@H](OCC1CCOCC1)CO2 |
| InChI | InChI=1S/C22H33NO3/c1-18-4-2-3-5-20(18)15-23-10-8-22(9-11-23)14-21(17-26-22)25-16-19-6-12-24-13-7-19/h2-5,19,21H,6-17H2,1H3/t21-/m1/s1 |
| InChIKey | RQSUKJOCFFNXEA-OAQYLSRUSA-N |
| XLogP | 3.56 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |