C16H29NO5S — CID 97474992
(3R)-8-ethylsulfonyl-3-(oxan-4-ylmethoxy)-1-oxa-8-azaspiro[4.5]decane (PubChem CID 97474992) has the molecular formula C16H29NO5S and a molecular weight of 347.48 g/mol. Its IUPAC name is (3R)-8-ethylsulfonyl-3-(oxan-4-ylmethoxy)-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3R)-8-ethylsulfonyl-3-(oxan-4-ylmethoxy)-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97474992 |
| Molecular Formula | C16H29NO5S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (3R)-8-ethylsulfonyl-3-(oxan-4-ylmethoxy)-1-oxa-8-azaspiro[4.5]decane |
| SMILES | CCS(=O)(=O)N1CCC2(CC1)C[C@@H](OCC1CCOCC1)CO2 |
| InChI | InChI=1S/C16H29NO5S/c1-2-23(18,19)17-7-5-16(6-8-17)11-15(13-22-16)21-12-14-3-9-20-10-4-14/h14-15H,2-13H2,1H3/t15-/m1/s1 |
| InChIKey | YGDFEBDYZYFYLV-OAHLLOKOSA-N |
| XLogP | 1.40 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |