C19H32N2O4 — CID 131650344
[3-(oxan-4-ylmethoxy)-1-oxa-8-azaspiro[4.5]decan-8-yl]-pyrrolidin-1-ylmethanone (PubChem CID 131650344) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is [3-(oxan-4-ylmethoxy)-1-oxa-8-azaspiro[4.5]decan-8-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-(oxan-4-ylmethoxy)-1-oxa-8-azaspiro[4.5]decan-8-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 131650344 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | [3-(oxan-4-ylmethoxy)-1-oxa-8-azaspiro[4.5]decan-8-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(N1CCCC1)N1CCC2(CC1)CC(OCC1CCOCC1)CO2 |
| InChI | InChI=1S/C19H32N2O4/c22-18(20-7-1-2-8-20)21-9-5-19(6-10-21)13-17(15-25-19)24-14-16-3-11-23-12-4-16/h16-17H,1-15H2 |
| InChIKey | YUPLEIJDZZOKPT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |