C19H29NO3S — CID 131649957
2-[(3-methylthiophen-2-yl)methyl]-8-(oxan-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonane (PubChem CID 131649957) has the molecular formula C19H29NO3S and a molecular weight of 351.51 g/mol. Its IUPAC name is 2-[(3-methylthiophen-2-yl)methyl]-8-(oxan-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonane.
| Compound Name | 2-[(3-methylthiophen-2-yl)methyl]-8-(oxan-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 131649957 |
| Molecular Formula | C19H29NO3S |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 2-[(3-methylthiophen-2-yl)methyl]-8-(oxan-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonane |
| SMILES | Cc1ccsc1CN1CC2(CC(OCC3CCOCC3)CCO2)C1 |
| InChI | InChI=1S/C19H29NO3S/c1-15-5-9-24-18(15)11-20-13-19(14-20)10-17(4-8-23-19)22-12-16-2-6-21-7-3-16/h5,9,16-17H,2-4,6-8,10-14H2,1H3 |
| InChIKey | PAMUKMOEFUFJLN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |