C19H22N2O4 — CID 131644782
furan-3-yl-[3-(pyridin-3-yloxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]methanone (PubChem CID 131644782) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is furan-3-yl-[3-(pyridin-3-yloxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]methanone.
| Compound Name | furan-3-yl-[3-(pyridin-3-yloxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
|---|---|
| PubChem CID | 131644782 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | furan-3-yl-[3-(pyridin-3-yloxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
| SMILES | O=C(c1ccoc1)N1CCC2(CC1)COC(COc1cccnc1)C2 |
| InChI | InChI=1S/C19H22N2O4/c22-18(15-3-9-23-12-15)21-7-4-19(5-8-21)10-17(25-14-19)13-24-16-2-1-6-20-11-16/h1-3,6,9,11-12,17H,4-5,7-8,10,13-14H2 |
| InChIKey | PEORCVDJZGEGPQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |