C21H28N2O3 — CID 131658739
cyclohexen-1-yl-[3-(pyridin-3-yloxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]methanone (PubChem CID 131658739) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is cyclohexen-1-yl-[3-(pyridin-3-yloxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]methanone.
| Compound Name | cyclohexen-1-yl-[3-(pyridin-3-yloxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
|---|---|
| PubChem CID | 131658739 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | cyclohexen-1-yl-[3-(pyridin-3-yloxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
| SMILES | O=C(C1=CCCCC1)N1CCC2(CC1)COC(COc1cccnc1)C2 |
| InChI | InChI=1S/C21H28N2O3/c24-20(17-5-2-1-3-6-17)23-11-8-21(9-12-23)13-19(26-16-21)15-25-18-7-4-10-22-14-18/h4-5,7,10,14,19H,1-3,6,8-9,11-13,15-16H2 |
| InChIKey | YSONTNJFUPFYBL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |