C20H26N2O3 — CID 97364027
[(4aR,8aR)-4a-(pyridin-3-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(cyclopenten-1-yl)methanone (PubChem CID 97364027) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is [(4aR,8aR)-4a-(pyridin-3-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(cyclopenten-1-yl)methanone.
| Compound Name | [(4aR,8aR)-4a-(pyridin-3-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(cyclopenten-1-yl)methanone |
|---|---|
| PubChem CID | 97364027 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | [(4aR,8aR)-4a-(pyridin-3-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(cyclopenten-1-yl)methanone |
| SMILES | O=C(C1=CCCC1)N1CC[C@H]2OCCC[C@]2(COc2cccnc2)C1 |
| InChI | InChI=1S/C20H26N2O3/c23-19(16-5-1-2-6-16)22-11-8-18-20(14-22,9-4-12-24-18)15-25-17-7-3-10-21-13-17/h3,5,7,10,13,18H,1-2,4,6,8-9,11-12,14-15H2/t18-,20-/m1/s1 |
| InChIKey | UGKUBDLREUYFLJ-UYAOXDASSA-N |
| XLogP | 2.97 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |