C19H22N2O3S — CID 124791193
[(3aR,7aS)-3a-(pyridin-3-yloxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-(5-methylthiophen-2-yl)methanone (PubChem CID 124791193) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is [(3aR,7aS)-3a-(pyridin-3-yloxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [(3aR,7aS)-3a-(pyridin-3-yloxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 124791193 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [(3aR,7aS)-3a-(pyridin-3-yloxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CC[C@@H]3OCC[C@]3(COc3cccnc3)C2)s1 |
| InChI | InChI=1S/C19H22N2O3S/c1-14-4-5-16(25-14)18(22)21-9-6-17-19(12-21,7-10-23-17)13-24-15-3-2-8-20-11-15/h2-5,8,11,17H,6-7,9-10,12-13H2,1H3/t17-,19+/m0/s1 |
| InChIKey | RGCUOEVGXUPXID-PKOBYXMFSA-N |
| XLogP | 3.15 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |