C19H22N2O3S — CID 97363997
[(4aR,8aS)-4a-(pyridin-3-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-thiophen-2-ylmethanone (PubChem CID 97363997) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is [(4aR,8aS)-4a-(pyridin-3-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-thiophen-2-ylmethanone.
| Compound Name | [(4aR,8aS)-4a-(pyridin-3-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 97363997 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [(4aR,8aS)-4a-(pyridin-3-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CC[C@@H]2OCCC[C@]2(COc2cccnc2)C1 |
| InChI | InChI=1S/C19H22N2O3S/c22-18(16-5-2-11-25-16)21-9-6-17-19(13-21,7-3-10-23-17)14-24-15-4-1-8-20-12-15/h1-2,4-5,8,11-12,17H,3,6-7,9-10,13-14H2/t17-,19+/m0/s1 |
| InChIKey | WDDHYTZSSYDDOT-PKOBYXMFSA-N |
| XLogP | 3.23 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |