C21H23F3N2O5S — CID 155854300
1-[(3aS,7aR)-3a-(pyridin-3-yloxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155854300) has the molecular formula C21H23F3N2O5S and a molecular weight of 472.49 g/mol. Its IUPAC name is 1-[(3aS,7aR)-3a-(pyridin-3-yloxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3aS,7aR)-3a-(pyridin-3-yloxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155854300 |
| Molecular Formula | C21H23F3N2O5S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 1-[(3aS,7aR)-3a-(pyridin-3-yloxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Cc1cccs1)N1CC[C@H]2OCC[C@@]2(COc2cccnc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H22N2O3S.C2HF3O2/c22-18(11-16-4-2-10-25-16)21-8-5-17-19(13-21,6-9-23-17)14-24-15-3-1-7-20-12-15;3-2(4,5)1(6)7/h1-4,7,10,12,17H,5-6,8-9,11,13-14H2;(H,6,7)/t17-,19+;/m1./s1 |
| InChIKey | SZOYBKYNLXLSAU-ZFNKBKEPSA-N |
| XLogP | 3.41 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |