C19H32N2O3 — CID 131639594
[4a-[2-(dimethylamino)ethoxymethyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(cyclopenten-1-yl)methanone (PubChem CID 131639594) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is [4a-[2-(dimethylamino)ethoxymethyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(cyclopenten-1-yl)methanone.
| Compound Name | [4a-[2-(dimethylamino)ethoxymethyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(cyclopenten-1-yl)methanone |
|---|---|
| PubChem CID | 131639594 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | [4a-[2-(dimethylamino)ethoxymethyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(cyclopenten-1-yl)methanone |
| SMILES | CN(C)CCOCC12CCCOC1CCN(C(=O)C1=CCCC1)C2 |
| InChI | InChI=1S/C19H32N2O3/c1-20(2)11-13-23-15-19-9-5-12-24-17(19)8-10-21(14-19)18(22)16-6-3-4-7-16/h6,17H,3-5,7-15H2,1-2H3 |
| InChIKey | KDXZELRJWQGADC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|