C17H23N3O3 — CID 125004221
oxan-4-yl-[(7R)-7-(pyrimidin-5-ylmethyl)-6-oxa-2-azaspiro[3.4]octan-2-yl]methanone (PubChem CID 125004221) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is oxan-4-yl-[(7R)-7-(pyrimidin-5-ylmethyl)-6-oxa-2-azaspiro[3.4]octan-2-yl]methanone.
| Compound Name | oxan-4-yl-[(7R)-7-(pyrimidin-5-ylmethyl)-6-oxa-2-azaspiro[3.4]octan-2-yl]methanone |
|---|---|
| PubChem CID | 125004221 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | oxan-4-yl-[(7R)-7-(pyrimidin-5-ylmethyl)-6-oxa-2-azaspiro[3.4]octan-2-yl]methanone |
| SMILES | O=C(C1CCOCC1)N1CC2(CO[C@H](Cc3cncnc3)C2)C1 |
| InChI | InChI=1S/C17H23N3O3/c21-16(14-1-3-22-4-2-14)20-9-17(10-20)6-15(23-11-17)5-13-7-18-12-19-8-13/h7-8,12,14-15H,1-6,9-11H2/t15-/m1/s1 |
| InChIKey | SXAYZFOTAYQIDK-OAHLLOKOSA-N |
| XLogP | 1.06 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |