C27H31ClN2O3 — CID 110138756
1-[2-[3-[(3aR,4R,6aS)-4-[(2-chlorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]phenoxy]ethyl]pyrrolidin-2-one (PubChem CID 110138756) has the molecular formula C27H31ClN2O3 and a molecular weight of 467.01 g/mol. Its IUPAC name is 1-[2-[3-[(3aR,4R,6aS)-4-[(2-chlorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]phenoxy]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[3-[(3aR,4R,6aS)-4-[(2-chlorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]phenoxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 110138756 |
| Molecular Formula | C27H31ClN2O3 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 1-[2-[3-[(3aR,4R,6aS)-4-[(2-chlorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]phenoxy]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCOc1cccc(C(=O)N2C[C@H]3CC[C@H](Cc4ccccc4Cl)[C@H]3C2)c1 |
| InChI | InChI=1S/C27H31ClN2O3/c28-25-8-2-1-5-20(25)15-19-10-11-22-17-30(18-24(19)22)27(32)21-6-3-7-23(16-21)33-14-13-29-12-4-9-26(29)31/h1-3,5-8,16,19,22,24H,4,9-15,17-18H2/t19-,22-,24-/m1/s1 |
| InChIKey | YLTAUXZKRZRVSF-ZFJSRUIDSA-N |
| XLogP | 4.68 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |