C29H33N3O3 — CID 129454058
1-[2-[3-[(4S)-4-(isoquinolin-4-ylmethyl)azepane-1-carbonyl]phenoxy]ethyl]pyrrolidin-2-one (PubChem CID 129454058) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 1-[2-[3-[(4S)-4-(isoquinolin-4-ylmethyl)azepane-1-carbonyl]phenoxy]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[3-[(4S)-4-(isoquinolin-4-ylmethyl)azepane-1-carbonyl]phenoxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 129454058 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 1-[2-[3-[(4S)-4-(isoquinolin-4-ylmethyl)azepane-1-carbonyl]phenoxy]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCOc1cccc(C(=O)N2CCC[C@@H](Cc3cncc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C29H33N3O3/c33-28-11-5-13-31(28)16-17-35-26-9-3-8-23(19-26)29(34)32-14-4-6-22(12-15-32)18-25-21-30-20-24-7-1-2-10-27(24)25/h1-3,7-10,19-22H,4-6,11-18H2/t22-/m1/s1 |
| InChIKey | CRHDCZDINROTIM-JOCHJYFZSA-N |
| XLogP | 4.72 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |