C27H34N4O3 — CID 124946567
[(4R)-4-(1H-indazol-5-ylmethyl)azepan-1-yl]-[3-(2-morpholin-4-ylethoxy)phenyl]methanone (PubChem CID 124946567) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is [(4R)-4-(1H-indazol-5-ylmethyl)azepan-1-yl]-[3-(2-morpholin-4-ylethoxy)phenyl]methanone.
| Compound Name | [(4R)-4-(1H-indazol-5-ylmethyl)azepan-1-yl]-[3-(2-morpholin-4-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 124946567 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [(4R)-4-(1H-indazol-5-ylmethyl)azepan-1-yl]-[3-(2-morpholin-4-ylethoxy)phenyl]methanone |
| SMILES | O=C(c1cccc(OCCN2CCOCC2)c1)N1CCC[C@H](Cc2ccc3[nH]ncc3c2)CC1 |
| InChI | InChI=1S/C27H34N4O3/c32-27(23-4-1-5-25(19-23)34-16-13-30-11-14-33-15-12-30)31-9-2-3-21(8-10-31)17-22-6-7-26-24(18-22)20-28-29-26/h1,4-7,18-21H,2-3,8-17H2,(H,28,29)/t21-/m0/s1 |
| InChIKey | BZBQFRXKYZHOMU-NRFANRHFSA-N |
| XLogP | 3.76 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |