C21H29N3O2 — CID 125016324
1-[(4S)-4-(1H-indazol-5-ylmethyl)azepan-1-yl]-2-(oxan-4-yl)ethanone (PubChem CID 125016324) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-[(4S)-4-(1H-indazol-5-ylmethyl)azepan-1-yl]-2-(oxan-4-yl)ethanone.
| Compound Name | 1-[(4S)-4-(1H-indazol-5-ylmethyl)azepan-1-yl]-2-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 125016324 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1-[(4S)-4-(1H-indazol-5-ylmethyl)azepan-1-yl]-2-(oxan-4-yl)ethanone |
| SMILES | O=C(CC1CCOCC1)N1CCC[C@@H](Cc2ccc3[nH]ncc3c2)CC1 |
| InChI | InChI=1S/C21H29N3O2/c25-21(14-17-6-10-26-11-7-17)24-8-1-2-16(5-9-24)12-18-3-4-20-19(13-18)15-22-23-20/h3-4,13,15-17H,1-2,5-12,14H2,(H,22,23)/t16-/m1/s1 |
| InChIKey | WZRVSBSXRIIYPN-MRXNPFEDSA-N |
| XLogP | 3.55 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |