C23H30N4O2 — CID 91906989
4-[3-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]piperidin-1-yl]-1H-pyridazin-6-one (PubChem CID 91906989) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-[3-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]piperidin-1-yl]-1H-pyridazin-6-one.
| Compound Name | 4-[3-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]piperidin-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 91906989 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 4-[3-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]piperidin-1-yl]-1H-pyridazin-6-one |
| SMILES | O=C(CC1CCCN(c2cn[nH]c(=O)c2)C1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N4O2/c28-22-15-21(16-24-25-22)27-10-4-7-20(17-27)14-23(29)26-11-8-19(9-12-26)13-18-5-2-1-3-6-18/h1-3,5-6,15-16,19-20H,4,7-14,17H2,(H,25,28) |
| InChIKey | BRQLGRUAMLILET-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |