C29H35N3O3 — CID 132773480
[4-(isoquinolin-6-ylmethyl)azepan-1-yl]-[3-(2-morpholin-4-ylethoxy)phenyl]methanone (PubChem CID 132773480) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is [4-(isoquinolin-6-ylmethyl)azepan-1-yl]-[3-(2-morpholin-4-ylethoxy)phenyl]methanone.
| Compound Name | [4-(isoquinolin-6-ylmethyl)azepan-1-yl]-[3-(2-morpholin-4-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 132773480 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | [4-(isoquinolin-6-ylmethyl)azepan-1-yl]-[3-(2-morpholin-4-ylethoxy)phenyl]methanone |
| SMILES | O=C(c1cccc(OCCN2CCOCC2)c1)N1CCCC(Cc2ccc3cnccc3c2)CC1 |
| InChI | InChI=1S/C29H35N3O3/c33-29(26-4-1-5-28(21-26)35-18-15-31-13-16-34-17-14-31)32-11-2-3-23(9-12-32)19-24-6-7-27-22-30-10-8-25(27)20-24/h1,4-8,10,20-23H,2-3,9,11-19H2 |
| InChIKey | XIWVETQAHLIKOJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |