C22H24N4O — CID 124988569
[(4S)-4-(isoquinolin-6-ylmethyl)azepan-1-yl]-(5-methylpyrazin-2-yl)methanone (PubChem CID 124988569) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is [(4S)-4-(isoquinolin-6-ylmethyl)azepan-1-yl]-(5-methylpyrazin-2-yl)methanone.
| Compound Name | [(4S)-4-(isoquinolin-6-ylmethyl)azepan-1-yl]-(5-methylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 124988569 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [(4S)-4-(isoquinolin-6-ylmethyl)azepan-1-yl]-(5-methylpyrazin-2-yl)methanone |
| SMILES | Cc1cnc(C(=O)N2CCC[C@@H](Cc3ccc4cnccc4c3)CC2)cn1 |
| InChI | InChI=1S/C22H24N4O/c1-16-13-25-21(15-24-16)22(27)26-9-2-3-17(7-10-26)11-18-4-5-20-14-23-8-6-19(20)12-18/h4-6,8,12-15,17H,2-3,7,9-11H2,1H3/t17-/m1/s1 |
| InChIKey | ONPPGEODBWOGIE-QGZVFWFLSA-N |
| XLogP | 3.82 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |