C20H22N6O — CID 110143448
[(3aS,4R,6aR)-4-(pyrazin-2-ylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(7-methylimidazo[1,2-a]pyridin-2-yl)methanone (PubChem CID 110143448) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is [(3aS,4R,6aR)-4-(pyrazin-2-ylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(7-methylimidazo[1,2-a]pyridin-2-yl)methanone.
| Compound Name | [(3aS,4R,6aR)-4-(pyrazin-2-ylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(7-methylimidazo[1,2-a]pyridin-2-yl)methanone |
|---|---|
| PubChem CID | 110143448 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | [(3aS,4R,6aR)-4-(pyrazin-2-ylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(7-methylimidazo[1,2-a]pyridin-2-yl)methanone |
| SMILES | Cc1ccn2cc(C(=O)N3C[C@@H]4CC[C@@H](Nc5cnccn5)[C@@H]4C3)nc2c1 |
| InChI | InChI=1S/C20H22N6O/c1-13-4-7-25-12-17(24-19(25)8-13)20(27)26-10-14-2-3-16(15(14)11-26)23-18-9-21-5-6-22-18/h4-9,12,14-16H,2-3,10-11H2,1H3,(H,22,23)/t14-,15+,16+/m0/s1 |
| InChIKey | NYINKCVQRDCISU-ARFHVFGLSA-N |
| XLogP | 2.40 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |