C18H27N5O — CID 155986841
1-[4-[(3aR,4R,6aS)-4-(pyrazin-2-ylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]piperidin-1-yl]ethanone (PubChem CID 155986841) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is 1-[4-[(3aR,4R,6aS)-4-(pyrazin-2-ylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(3aR,4R,6aS)-4-(pyrazin-2-ylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 155986841 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 1-[4-[(3aR,4R,6aS)-4-(pyrazin-2-ylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(N2C[C@H]3CC[C@@H](Nc4cnccn4)[C@H]3C2)CC1 |
| InChI | InChI=1S/C18H27N5O/c1-13(24)22-8-4-15(5-9-22)23-11-14-2-3-17(16(14)12-23)21-18-10-19-6-7-20-18/h6-7,10,14-17H,2-5,8-9,11-12H2,1H3,(H,20,21)/t14-,16+,17-/m1/s1 |
| InChIKey | OSCMRXTZQVQNPO-HYVNUMGLSA-N |
| XLogP | 1.61 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |