C12H16N4O2 — CID 89068665
prop-1-en-2-yl (3R)-3-(pyrazin-2-ylamino)pyrrolidine-1-carboxylate (PubChem CID 89068665) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is prop-1-en-2-yl (3R)-3-(pyrazin-2-ylamino)pyrrolidine-1-carboxylate.
| Compound Name | prop-1-en-2-yl (3R)-3-(pyrazin-2-ylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 89068665 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | prop-1-en-2-yl (3R)-3-(pyrazin-2-ylamino)pyrrolidine-1-carboxylate |
| SMILES | C=C(C)OC(=O)N1CC[C@@H](Nc2cnccn2)C1 |
| InChI | InChI=1S/C12H16N4O2/c1-9(2)18-12(17)16-6-3-10(8-16)15-11-7-13-4-5-14-11/h4-5,7,10H,1,3,6,8H2,2H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | YEQRJHMFANYVBH-SNVBAGLBSA-N |
| XLogP | 1.63 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|