C20H31N3O2 — CID 110143715
[(3aR,9aR)-2,3,3a,4,5,6,7,8,9,9a-decahydropyrrolo[3,2-b]azocin-1-yl]-[2-[2-(dimethylamino)ethoxy]phenyl]methanone (PubChem CID 110143715) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is [(3aR,9aR)-2,3,3a,4,5,6,7,8,9,9a-decahydropyrrolo[3,2-b]azocin-1-yl]-[2-[2-(dimethylamino)ethoxy]phenyl]methanone.
| Compound Name | [(3aR,9aR)-2,3,3a,4,5,6,7,8,9,9a-decahydropyrrolo[3,2-b]azocin-1-yl]-[2-[2-(dimethylamino)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 110143715 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | [(3aR,9aR)-2,3,3a,4,5,6,7,8,9,9a-decahydropyrrolo[3,2-b]azocin-1-yl]-[2-[2-(dimethylamino)ethoxy]phenyl]methanone |
| SMILES | CN(C)CCOc1ccccc1C(=O)N1CC[C@H]2NCCCCC[C@H]21 |
| InChI | InChI=1S/C20H31N3O2/c1-22(2)14-15-25-19-10-6-5-8-16(19)20(24)23-13-11-17-18(23)9-4-3-7-12-21-17/h5-6,8,10,17-18,21H,3-4,7,9,11-15H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | FQNXTDQKGAUOAR-QZTJIDSGSA-N |
| XLogP | 2.37 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |