C21H25N5O3 — CID 110145311
[4-(3-aminopropoxy)phenyl]-[(3S,4S)-3-hydroxy-4-(imidazo[1,2-a]pyrazin-6-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 110145311) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is [4-(3-aminopropoxy)phenyl]-[(3S,4S)-3-hydroxy-4-(imidazo[1,2-a]pyrazin-6-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [4-(3-aminopropoxy)phenyl]-[(3S,4S)-3-hydroxy-4-(imidazo[1,2-a]pyrazin-6-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 110145311 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [4-(3-aminopropoxy)phenyl]-[(3S,4S)-3-hydroxy-4-(imidazo[1,2-a]pyrazin-6-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | NCCCOc1ccc(C(=O)N2C[C@H](Cc3cn4ccnc4cn3)[C@H](O)C2)cc1 |
| InChI | InChI=1S/C21H25N5O3/c22-6-1-9-29-18-4-2-15(3-5-18)21(28)26-12-16(19(27)14-26)10-17-13-25-8-7-23-20(25)11-24-17/h2-5,7-8,11,13,16,19,27H,1,6,9-10,12,14,22H2/t16-,19+/m0/s1 |
| InChIKey | RKBOXSTXJBAQKC-QFBILLFUSA-N |
| XLogP | 1.13 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|