C16H25NO8Si — CID 11014549
methyl (Z)-4-[(2S)-1-(1-acetyloxy-2-methoxy-2-oxoethyl)-4-oxoazetidin-2-yl]-3-trimethylsilyloxybut-2-enoate (PubChem CID 11014549) has the molecular formula C16H25NO8Si and a molecular weight of 387.46 g/mol. Its IUPAC name is methyl (Z)-4-[(2S)-1-(1-acetyloxy-2-methoxy-2-oxoethyl)-4-oxoazetidin-2-yl]-3-trimethylsilyloxybut-2-enoate.
| Compound Name | methyl (Z)-4-[(2S)-1-(1-acetyloxy-2-methoxy-2-oxoethyl)-4-oxoazetidin-2-yl]-3-trimethylsilyloxybut-2-enoate |
|---|---|
| PubChem CID | 11014549 |
| Molecular Formula | C16H25NO8Si |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | methyl (Z)-4-[(2S)-1-(1-acetyloxy-2-methoxy-2-oxoethyl)-4-oxoazetidin-2-yl]-3-trimethylsilyloxybut-2-enoate |
| SMILES | COC(=O)/C=C(/C[C@H]1CC(=O)N1C(OC(C)=O)C(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C16H25NO8Si/c1-10(18)24-15(16(21)23-3)17-11(8-13(17)19)7-12(9-14(20)22-2)25-26(4,5)6/h9,11,15H,7-8H2,1-6H3/b12-9-/t11-,15?/m0/s1 |
| InChIKey | WSBRGQKBBWNHAZ-NIKOZTQWSA-N |
| XLogP | 0.95 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|