C25H31N3O3 — CID 110145715
1-[(3S,3aS,7aR)-5-[3-(3-aminopropoxy)benzoyl]-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone (PubChem CID 110145715) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-5-[3-(3-aminopropoxy)benzoyl]-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone.
| Compound Name | 1-[(3S,3aS,7aR)-5-[3-(3-aminopropoxy)benzoyl]-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 110145715 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 1-[(3S,3aS,7aR)-5-[3-(3-aminopropoxy)benzoyl]-3-phenyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
| SMILES | CC(=O)N1C[C@H](c2ccccc2)[C@H]2CN(C(=O)c3cccc(OCCCN)c3)CC[C@H]21 |
| InChI | InChI=1S/C25H31N3O3/c1-18(29)28-17-22(19-7-3-2-4-8-19)23-16-27(13-11-24(23)28)25(30)20-9-5-10-21(15-20)31-14-6-12-26/h2-5,7-10,15,22-24H,6,11-14,16-17,26H2,1H3/t22-,23-,24-/m1/s1 |
| InChIKey | KZKKAZIYCALNMC-WXFUMESZSA-N |
| XLogP | 2.89 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|